![2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene (CAS: 898566-17-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0646688.png "2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene chemical structure")
2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene
Catalog No: FT-0646688
CAS No: 898566-17-1
- Chemical Name: 2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene
- Molecular Formula: C18H14FIS
- Molecular Weight: 408.3
- InChI Key: MGXZKAYHSITHMW-UHFFFAOYSA-N
- InChI: InChI=1S/C18H14FIS/c1-12-2-7-16(20)10-14(12)11-17-8-9-18(21-17)13-3-5-15(19)6-4-13/h2-10H,11H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 408.272 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 898566-17-1 |
| Bolling_Point: | 450.2±45.0 °C at 760 mmHg |
| Product_Name: | 2-(4-Fluorophenyl)-5-[(5-iodo-2-Methylphenyl)methyl]thiophene |
| Melting_Point: | N/A |
| Flash_Point: | 226.1±28.7 °C |
| MF: | C18H14FIS |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 7.20 |
| Flash_Point: | 226.1±28.7 °C |
| Refractive_Index: | 1.643 |
| FW: | 408.272 |
| PSA: | 28.24000 |
| MF: | C18H14FIS |
| Bolling_Point: | 450.2±45.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Exact_Mass: | 407.984497 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318-H413 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)